C12H8BrFN2O3 — CID 104782111
7-(3-bromo-4-fluorophenyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione (PubChem CID 104782111) has the molecular formula C12H8BrFN2O3 and a molecular weight of 327.11 g/mol. Its IUPAC name is 7-(3-bromo-4-fluorophenyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione.
| Compound Name | 7-(3-bromo-4-fluorophenyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione |
|---|---|
| PubChem CID | 104782111 |
| Molecular Formula | C12H8BrFN2O3 |
| Molecular Weight | 327.11 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 7-(3-bromo-4-fluorophenyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione |
| SMILES | O=C1NC(=O)C2(CC2)C(=O)N1c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C12H8BrFN2O3/c13-7-5-6(1-2-8(7)14)16-10(18)12(3-4-12)9(17)15-11(16)19/h1-2,5H,3-4H2,(H,15,17,19) |
| InChIKey | MYGHWYIALIUYJQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.11 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|