C25H29NO6 — CID 10478353
(4R,5S)-3-[(2R,3S)-3-hydroxy-5-(methoxymethoxy)-2-[(E)-2-phenylethenyl]pentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 10478353) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is (4R,5S)-3-[(2R,3S)-3-hydroxy-5-(methoxymethoxy)-2-[(E)-2-phenylethenyl]pentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(2R,3S)-3-hydroxy-5-(methoxymethoxy)-2-[(E)-2-phenylethenyl]pentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10478353 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | (4R,5S)-3-[(2R,3S)-3-hydroxy-5-(methoxymethoxy)-2-[(E)-2-phenylethenyl]pentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | COCOCC[C@H](O)[C@@H](/C=C/c1ccccc1)C(=O)N1C(=O)O[C@@H](c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C25H29NO6/c1-18-23(20-11-7-4-8-12-20)32-25(29)26(18)24(28)21(22(27)15-16-31-17-30-2)14-13-19-9-5-3-6-10-19/h3-14,18,21-23,27H,15-17H2,1-2H3/b14-13+/t18-,21-,22+,23-/m1/s1 |
| InChIKey | QRLPXMTYQGJNIS-HWXUPALISA-N |
| XLogP | 3.80 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|