C11H12N4O4 — CID 104784672
1-[5-(2-methoxy-4-nitrophenyl)-1,3,4-oxadiazol-2-yl]-N-methylmethanamine (PubChem CID 104784672) has the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is 1-[5-(2-methoxy-4-nitrophenyl)-1,3,4-oxadiazol-2-yl]-N-methylmethanamine.
| Compound Name | 1-[5-(2-methoxy-4-nitrophenyl)-1,3,4-oxadiazol-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 104784672 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 1-[5-(2-methoxy-4-nitrophenyl)-1,3,4-oxadiazol-2-yl]-N-methylmethanamine |
| SMILES | CNCc1nnc(-c2ccc([N+](=O)[O-])cc2OC)o1 |
| InChI | InChI=1S/C11H12N4O4/c1-12-6-10-13-14-11(19-10)8-4-3-7(15(16)17)5-9(8)18-2/h3-5,12H,6H2,1-2H3 |
| InChIKey | DCAXWHOEUOMTSI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|