C13H15ClN2O5 — CID 104784771
[2-(chloromethyl)morpholin-4-yl]-(2-methoxy-4-nitrophenyl)methanone (PubChem CID 104784771) has the molecular formula C13H15ClN2O5 and a molecular weight of 314.72 g/mol. Its IUPAC name is [2-(chloromethyl)morpholin-4-yl]-(2-methoxy-4-nitrophenyl)methanone.
| Compound Name | [2-(chloromethyl)morpholin-4-yl]-(2-methoxy-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 104784771 |
| Molecular Formula | C13H15ClN2O5 |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | [2-(chloromethyl)morpholin-4-yl]-(2-methoxy-4-nitrophenyl)methanone |
| SMILES | COc1cc([N+](=O)[O-])ccc1C(=O)N1CCOC(CCl)C1 |
| InChI | InChI=1S/C13H15ClN2O5/c1-20-12-6-9(16(18)19)2-3-11(12)13(17)15-4-5-21-10(7-14)8-15/h2-3,6,10H,4-5,7-8H2,1H3 |
| InChIKey | UQRBLCHYFCSDFD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|