About N'-[(5-fluoro-3-pyridinyl)methyl]-N'-methyl-N-propan-2-ylethane-1,2-diamine
N'-[(5-fluoro-3-pyridinyl)methyl]-N'-methyl-N-propan-2-ylethane-1,2-diamine (PubChem CID 104785806) has the molecular formula C12H20FN3
and a molecular weight of 225.31 g/mol. Its IUPAC name is N'-[(5-fluoro-3-pyridinyl)methyl]-N'-methyl-N-propan-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(5-fluoro-3-pyridinyl)methyl]-N'-methyl-N-propan-2-ylethane-1,2-diamine |
| PubChem CID | 104785806 |
| Molecular Formula | C12H20FN3 |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | N'-[(5-fluoro-3-pyridinyl)methyl]-N'-methyl-N-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)NCCN(C)Cc1cncc(F)c1 |
| InChI | InChI=1S/C12H20FN3/c1-10(2)15-4-5-16(3)9-11-6-12(13)8-14-7-11/h6-8,10,15H,4-5,9H2,1-3H3 |
| InChIKey | SMLGDPXQCWEPAT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-[(5-fluoro-3-pyridinyl)methyl]-N'-methyl-N-propan-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(5-fluoro-3-pyridinyl)methyl]-N'-methyl-N-propan-2-ylethane-1,2-diamine?
The IUPAC name of N'-[(5-fluoro-3-pyridinyl)methyl]-N'-methyl-N-propan-2-ylethane-1,2-diamine (CID 104785806) is N'-[(5-fluoro-3-pyridinyl)methyl]-N'-methyl-N-propan-2-ylethane-1,2-diamine.
What is the SMILES notation for N'-[(5-fluoro-3-pyridinyl)methyl]-N'-methyl-N-propan-2-ylethane-1,2-diamine?
The canonical SMILES for N'-[(5-fluoro-3-pyridinyl)methyl]-N'-methyl-N-propan-2-ylethane-1,2-diamine is CC(C)NCCN(C)Cc1cncc(F)c1.
What is the InChIKey of N'-[(5-fluoro-3-pyridinyl)methyl]-N'-methyl-N-propan-2-ylethane-1,2-diamine?
The InChIKey is SMLGDPXQCWEPAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20FN3/c1-10(2)15-4-5-16(3)9-11-6-12(13)8-14-7-11/h6-8,10,15H,4-5,9H2,1-3H3.
What are the key properties of N'-[(5-fluoro-3-pyridinyl)methyl]-N'-methyl-N-propan-2-ylethane-1,2-diamine?
N'-[(5-fluoro-3-pyridinyl)methyl]-N'-methyl-N-propan-2-ylethane-1,2-diamine has a molecular weight of 225.31 g/mol, XLogP of 1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(5-fluoro-3-pyridinyl)methyl]-N'-methyl-N-propan-2-ylethane-1,2-diamine is sourced from PubChem (CID 104785806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).