C9H12ClN5O — CID 104786985
2-[(2-chloro-7H-purin-6-yl)oxy]-N,N-dimethylethanamine (PubChem CID 104786985) has the molecular formula C9H12ClN5O and a molecular weight of 241.68 g/mol. Its IUPAC name is 2-[(2-chloro-7H-purin-6-yl)oxy]-N,N-dimethylethanamine.
| Compound Name | 2-[(2-chloro-7H-purin-6-yl)oxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 104786985 |
| Molecular Formula | C9H12ClN5O |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-[(2-chloro-7H-purin-6-yl)oxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C9H12ClN5O/c1-15(2)3-4-16-8-6-7(12-5-11-6)13-9(10)14-8/h5H,3-4H2,1-2H3,(H,11,12,13,14) |
| InChIKey | FOXRUZZYQFGLIE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |