C15H23NO2 — CID 104789677
(2-methylfuran-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methanamine (PubChem CID 104789677) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (2-methylfuran-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methanamine.
| Compound Name | (2-methylfuran-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methanamine |
|---|---|
| PubChem CID | 104789677 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (2-methylfuran-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methanamine |
| SMILES | Cc1occc1C(N)C1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C15H23NO2/c1-11-13(5-8-17-11)14(16)12-4-9-18-15(10-12)6-2-3-7-15/h5,8,12,14H,2-4,6-7,9-10,16H2,1H3 |
| InChIKey | QLVZWRHSXUJOEG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |