C14H14F3NO — CID 104789859
N-methyl-1-(2-methylfuran-3-yl)-1-[2-(trifluoromethyl)phenyl]methanamine (PubChem CID 104789859) has the molecular formula C14H14F3NO and a molecular weight of 269.27 g/mol. Its IUPAC name is N-methyl-1-(2-methylfuran-3-yl)-1-[2-(trifluoromethyl)phenyl]methanamine.
| Compound Name | N-methyl-1-(2-methylfuran-3-yl)-1-[2-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 104789859 |
| Molecular Formula | C14H14F3NO |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N-methyl-1-(2-methylfuran-3-yl)-1-[2-(trifluoromethyl)phenyl]methanamine |
| SMILES | CNC(c1ccccc1C(F)(F)F)c1ccoc1C |
| InChI | InChI=1S/C14H14F3NO/c1-9-10(7-8-19-9)13(18-2)11-5-3-4-6-12(11)14(15,16)17/h3-8,13,18H,1-2H3 |
| InChIKey | WIMCRFCIODSYBH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |