C22H15Cl2N5S — CID 10479006
7,8-dichloro-4-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]-1,3-dihydro-1,5-benzodiazepine-2-thione (PubChem CID 10479006) has the molecular formula C22H15Cl2N5S and a molecular weight of 452.37 g/mol. Its IUPAC name is 7,8-dichloro-4-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]-1,3-dihydro-1,5-benzodiazepine-2-thione.
| Compound Name | 7,8-dichloro-4-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]-1,3-dihydro-1,5-benzodiazepine-2-thione |
|---|---|
| PubChem CID | 10479006 |
| Molecular Formula | C22H15Cl2N5S |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 7,8-dichloro-4-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]-1,3-dihydro-1,5-benzodiazepine-2-thione |
| SMILES | Cc1nc2cnccc2n1-c1ccc(C2=Nc3cc(Cl)c(Cl)cc3NC(=S)C2)cc1 |
| InChI | InChI=1S/C22H15Cl2N5S/c1-12-26-20-11-25-7-6-21(20)29(12)14-4-2-13(3-5-14)17-10-22(30)28-19-9-16(24)15(23)8-18(19)27-17/h2-9,11H,10H2,1H3,(H,28,30) |
| InChIKey | XGGMIFIFZUUOFF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|