C21H25O9P — CID 10479008
methyl 2-(3-dimethoxyphosphoryl-2-oxopropyl)-6-hydroxy-4-(phenylmethoxymethoxy)benzoate (PubChem CID 10479008) has the molecular formula C21H25O9P and a molecular weight of 452.40 g/mol. Its IUPAC name is methyl 2-(3-dimethoxyphosphoryl-2-oxopropyl)-6-hydroxy-4-(phenylmethoxymethoxy)benzoate.
| Compound Name | methyl 2-(3-dimethoxyphosphoryl-2-oxopropyl)-6-hydroxy-4-(phenylmethoxymethoxy)benzoate |
|---|---|
| PubChem CID | 10479008 |
| Molecular Formula | C21H25O9P |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | methyl 2-(3-dimethoxyphosphoryl-2-oxopropyl)-6-hydroxy-4-(phenylmethoxymethoxy)benzoate |
| SMILES | COC(=O)c1c(O)cc(OCOCc2ccccc2)cc1CC(=O)CP(=O)(OC)OC |
| InChI | InChI=1S/C21H25O9P/c1-26-21(24)20-16(9-17(22)13-31(25,27-2)28-3)10-18(11-19(20)23)30-14-29-12-15-7-5-4-6-8-15/h4-8,10-11,23H,9,12-14H2,1-3H3 |
| InChIKey | INPRZQIPKKDZTL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|