C13H16ClNOS — CID 104790134
2-(5-chlorothiophen-2-yl)-N-ethyl-1-(2-methylfuran-3-yl)ethanamine (PubChem CID 104790134) has the molecular formula C13H16ClNOS and a molecular weight of 269.80 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-ethyl-1-(2-methylfuran-3-yl)ethanamine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-ethyl-1-(2-methylfuran-3-yl)ethanamine |
|---|---|
| PubChem CID | 104790134 |
| Molecular Formula | C13H16ClNOS |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-ethyl-1-(2-methylfuran-3-yl)ethanamine |
| SMILES | CCNC(Cc1ccc(Cl)s1)c1ccoc1C |
| InChI | InChI=1S/C13H16ClNOS/c1-3-15-12(11-6-7-16-9(11)2)8-10-4-5-13(14)17-10/h4-7,12,15H,3,8H2,1-2H3 |
| InChIKey | FKCSPPLHMVGREF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |