C27H32O6 — CID 10479029
[1-(3,5-dimethoxyphenyl)-2-oxo-2-phenylethyl] [(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] carbonate (PubChem CID 10479029) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is [1-(3,5-dimethoxyphenyl)-2-oxo-2-phenylethyl] [(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] carbonate.
| Compound Name | [1-(3,5-dimethoxyphenyl)-2-oxo-2-phenylethyl] [(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] carbonate |
|---|---|
| PubChem CID | 10479029 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | [1-(3,5-dimethoxyphenyl)-2-oxo-2-phenylethyl] [(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] carbonate |
| SMILES | COc1cc(OC)cc(C(OC(=O)O[C@@H]2C[C@H]3CC[C@]2(C)C3(C)C)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H32O6/c1-26(2)19-11-12-27(26,3)22(15-19)32-25(29)33-24(23(28)17-9-7-6-8-10-17)18-13-20(30-4)16-21(14-18)31-5/h6-10,13-14,16,19,22,24H,11-12,15H2,1-5H3/t19-,22-,24?,27+/m1/s1 |
| InChIKey | RYUFHAXEGFSDRD-NRKACYSOSA-N |
| XLogP | 6.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |