C11H19NO2 — CID 104790452
N-[2-methoxy-1-(2-methylfuran-3-yl)ethyl]propan-1-amine (PubChem CID 104790452) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is N-[2-methoxy-1-(2-methylfuran-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-methoxy-1-(2-methylfuran-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 104790452 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | N-[2-methoxy-1-(2-methylfuran-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(COC)c1ccoc1C |
| InChI | InChI=1S/C11H19NO2/c1-4-6-12-11(8-13-3)10-5-7-14-9(10)2/h5,7,11-12H,4,6,8H2,1-3H3 |
| InChIKey | RQQMUZQSSDVEJT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |