C28H37ClN2O — CID 10479052
2-(5-chloro-2-phenyl-1H-indol-3-yl)-N,N-dihexylacetamide (PubChem CID 10479052) has the molecular formula C28H37ClN2O and a molecular weight of 453.07 g/mol. Its IUPAC name is 2-(5-chloro-2-phenyl-1H-indol-3-yl)-N,N-dihexylacetamide.
| Compound Name | 2-(5-chloro-2-phenyl-1H-indol-3-yl)-N,N-dihexylacetamide |
|---|---|
| PubChem CID | 10479052 |
| Molecular Formula | C28H37ClN2O |
| Molecular Weight | 453.07 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 2-(5-chloro-2-phenyl-1H-indol-3-yl)-N,N-dihexylacetamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)Cc1c(-c2ccccc2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C28H37ClN2O/c1-3-5-7-12-18-31(19-13-8-6-4-2)27(32)21-25-24-20-23(29)16-17-26(24)30-28(25)22-14-10-9-11-15-22/h9-11,14-17,20,30H,3-8,12-13,18-19,21H2,1-2H3 |
| InChIKey | IFHZALGTLOWGGG-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.07 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|