C23H18Cl2N4O2 — CID 10479055
2,2-dichloro-N-[2-[3-(2-phenylmethoxyphenyl)-1H-1,2,4-triazol-5-yl]phenyl]acetamide (PubChem CID 10479055) has the molecular formula C23H18Cl2N4O2 and a molecular weight of 453.33 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-[3-(2-phenylmethoxyphenyl)-1H-1,2,4-triazol-5-yl]phenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[2-[3-(2-phenylmethoxyphenyl)-1H-1,2,4-triazol-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 10479055 |
| Molecular Formula | C23H18Cl2N4O2 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 2,2-dichloro-N-[2-[3-(2-phenylmethoxyphenyl)-1H-1,2,4-triazol-5-yl]phenyl]acetamide |
| SMILES | O=C(Nc1ccccc1-c1nc(-c2ccccc2OCc2ccccc2)n[nH]1)C(Cl)Cl |
| InChI | InChI=1S/C23H18Cl2N4O2/c24-20(25)23(30)26-18-12-6-4-10-16(18)21-27-22(29-28-21)17-11-5-7-13-19(17)31-14-15-8-2-1-3-9-15/h1-13,20H,14H2,(H,26,30)(H,27,28,29) |
| InChIKey | RUKWHYCBGLRNCA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|