C12H12FN3O3 — CID 104792097
5-amino-1-[(2-fluoro-3-methoxyphenyl)methyl]pyrimidine-2,4-dione (PubChem CID 104792097) has the molecular formula C12H12FN3O3 and a molecular weight of 265.24 g/mol. Its IUPAC name is 5-amino-1-[(2-fluoro-3-methoxyphenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 5-amino-1-[(2-fluoro-3-methoxyphenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 104792097 |
| Molecular Formula | C12H12FN3O3 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 5-amino-1-[(2-fluoro-3-methoxyphenyl)methyl]pyrimidine-2,4-dione |
| SMILES | COc1cccc(Cn2cc(N)c(=O)[nH]c2=O)c1F |
| InChI | InChI=1S/C12H12FN3O3/c1-19-9-4-2-3-7(10(9)13)5-16-6-8(14)11(17)15-12(16)18/h2-4,6H,5,14H2,1H3,(H,15,17,18) |
| InChIKey | FKEXTVWQCBXTNP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |