C22H22F3N7O — CID 10479240
2-[3-[6-(2H-pyrazolo[3,4-b]pyridin-3-ylamino)-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]propylamino]ethanol (PubChem CID 10479240) has the molecular formula C22H22F3N7O and a molecular weight of 457.46 g/mol. Its IUPAC name is 2-[3-[6-(2H-pyrazolo[3,4-b]pyridin-3-ylamino)-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]propylamino]ethanol.
| Compound Name | 2-[3-[6-(2H-pyrazolo[3,4-b]pyridin-3-ylamino)-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]propylamino]ethanol |
|---|---|
| PubChem CID | 10479240 |
| Molecular Formula | C22H22F3N7O |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 2-[3-[6-(2H-pyrazolo[3,4-b]pyridin-3-ylamino)-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]propylamino]ethanol |
| SMILES | OCCNCCCc1cc(Nc2[nH]nc3ncccc23)nc(-c2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C22H22F3N7O/c23-22(24,25)17-8-2-1-6-15(17)20-28-14(5-3-9-26-11-12-33)13-18(29-20)30-21-16-7-4-10-27-19(16)31-32-21/h1-2,4,6-8,10,13,26,33H,3,5,9,11-12H2,(H2,27,28,29,30,31,32) |
| InChIKey | KIAZTGTVDUSYMD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|