C15H22FNO2 — CID 104794033
2-(2-fluoro-3-methoxyphenyl)-N-methyl-1-(oxan-3-yl)ethanamine (PubChem CID 104794033) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 2-(2-fluoro-3-methoxyphenyl)-N-methyl-1-(oxan-3-yl)ethanamine.
| Compound Name | 2-(2-fluoro-3-methoxyphenyl)-N-methyl-1-(oxan-3-yl)ethanamine |
|---|---|
| PubChem CID | 104794033 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-(2-fluoro-3-methoxyphenyl)-N-methyl-1-(oxan-3-yl)ethanamine |
| SMILES | CNC(Cc1cccc(OC)c1F)C1CCCOC1 |
| InChI | InChI=1S/C15H22FNO2/c1-17-13(12-6-4-8-19-10-12)9-11-5-3-7-14(18-2)15(11)16/h3,5,7,12-13,17H,4,6,8-10H2,1-2H3 |
| InChIKey | MBERKBZDKRTUEK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |