About [(E)-2,8-dimethyl-9-naphthalen-1-ylnon-5-en-3-yn-2-yl]-trimethylazanium iodide
[(E)-2,8-dimethyl-9-naphthalen-1-ylnon-5-en-3-yn-2-yl]-trimethylazanium iodide (PubChem CID 10479415) has the molecular formula C24H32IN
and a molecular weight of 461.43 g/mol. Its IUPAC name is [(E)-2,8-dimethyl-9-naphthalen-1-ylnon-5-en-3-yn-2-yl]-trimethylazanium iodide.
Molecular Properties
| Compound Name | [(E)-2,8-dimethyl-9-naphthalen-1-ylnon-5-en-3-yn-2-yl]-trimethylazanium iodide |
| PubChem CID | 10479415 |
| Molecular Formula | C24H32IN |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | [(E)-2,8-dimethyl-9-naphthalen-1-ylnon-5-en-3-yn-2-yl]-trimethylazanium iodide |
| SMILES | CC(C/C=C/C#CC(C)(C)[N+](C)(C)C)Cc1cccc2ccccc12.[I-] |
| InChI | InChI=1S/C24H32N.HI/c1-20(13-8-7-11-18-24(2,3)25(4,5)6)19-22-16-12-15-21-14-9-10-17-23(21)22;/h7-10,12,14-17,20H,13,19H2,1-6H3;1H/q+1;/p-1/b8-7+; |
| InChIKey | XVIRBJQTBQIYEF-USRGLUTNSA-M |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2,8-dimethyl-9-naphthalen-1-ylnon-5-en-3-yn-2-yl]-trimethylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2,8-dimethyl-9-naphthalen-1-ylnon-5-en-3-yn-2-yl]-trimethylazanium iodide?
The IUPAC name of [(E)-2,8-dimethyl-9-naphthalen-1-ylnon-5-en-3-yn-2-yl]-trimethylazanium iodide (CID 10479415) is [(E)-2,8-dimethyl-9-naphthalen-1-ylnon-5-en-3-yn-2-yl]-trimethylazanium iodide.
What is the SMILES notation for [(E)-2,8-dimethyl-9-naphthalen-1-ylnon-5-en-3-yn-2-yl]-trimethylazanium iodide?
The canonical SMILES for [(E)-2,8-dimethyl-9-naphthalen-1-ylnon-5-en-3-yn-2-yl]-trimethylazanium iodide is CC(C/C=C/C#CC(C)(C)[N+](C)(C)C)Cc1cccc2ccccc12.[I-].
What is the InChIKey of [(E)-2,8-dimethyl-9-naphthalen-1-ylnon-5-en-3-yn-2-yl]-trimethylazanium iodide?
The InChIKey is XVIRBJQTBQIYEF-USRGLUTNSA-M. The full InChI is InChI=1S/C24H32N.HI/c1-20(13-8-7-11-18-24(2,3)25(4,5)6)19-22-16-12-15-21-14-9-10-17-23(21)22;/h7-10,12,14-17,20H,13,19H2,1-6H3;1H/q+1;/p-1/b8-7+;.
What are the key properties of [(E)-2,8-dimethyl-9-naphthalen-1-ylnon-5-en-3-yn-2-yl]-trimethylazanium iodide?
[(E)-2,8-dimethyl-9-naphthalen-1-ylnon-5-en-3-yn-2-yl]-trimethylazanium iodide has a molecular weight of 461.43 g/mol, XLogP of 2.46, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2,8-dimethyl-9-naphthalen-1-ylnon-5-en-3-yn-2-yl]-trimethylazanium iodide is sourced from PubChem (CID 10479415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).