C21H24FN5O4S — CID 10479425
N-[[(5S)-3-[3-fluoro-4-[4-(2-methyl-1,3-oxazole-5-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 10479425) has the molecular formula C21H24FN5O4S and a molecular weight of 461.52 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-(2-methyl-1,3-oxazole-5-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-(2-methyl-1,3-oxazole-5-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10479425 |
| Molecular Formula | C21H24FN5O4S |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-(2-methyl-1,3-oxazole-5-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(C(=S)c4cnc(C)o4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H24FN5O4S/c1-13(28)23-10-16-12-27(21(29)31-16)15-3-4-18(17(22)9-15)25-5-7-26(8-6-25)20(32)19-11-24-14(2)30-19/h3-4,9,11,16H,5-8,10,12H2,1-2H3,(H,23,28)/t16-/m0/s1 |
| InChIKey | JERLRJGTXXNBPE-INIZCTEOSA-N |
| XLogP | 2.08 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|