C25H32N4O5 — CID 10479752
(2R)-5-N-benzyl-1-N-hydroxy-2-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentane-1,2,5-tricarboxamide (PubChem CID 10479752) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is (2R)-5-N-benzyl-1-N-hydroxy-2-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentane-1,2,5-tricarboxamide.
| Compound Name | (2R)-5-N-benzyl-1-N-hydroxy-2-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentane-1,2,5-tricarboxamide |
|---|---|
| PubChem CID | 10479752 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | (2R)-5-N-benzyl-1-N-hydroxy-2-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentane-1,2,5-tricarboxamide |
| SMILES | CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCC(=O)NCc1ccccc1)CC(=O)NO |
| InChI | InChI=1S/C25H32N4O5/c1-26-25(33)21(15-18-9-4-2-5-10-18)28-24(32)20(16-23(31)29-34)13-8-14-22(30)27-17-19-11-6-3-7-12-19/h2-7,9-12,20-21,34H,8,13-17H2,1H3,(H,26,33)(H,27,30)(H,28,32)(H,29,31)/t20-,21+/m1/s1 |
| InChIKey | ALDQBTGTDJBFBQ-RTWAWAEBSA-N |
| XLogP | 1.46 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|