C32H39NO2 — CID 10479804
4-(7,7,10,10-tetramethyl-1-pentyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoic acid (PubChem CID 10479804) has the molecular formula C32H39NO2 and a molecular weight of 469.67 g/mol. Its IUPAC name is 4-(7,7,10,10-tetramethyl-1-pentyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoic acid.
| Compound Name | 4-(7,7,10,10-tetramethyl-1-pentyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 10479804 |
| Molecular Formula | C32H39NO2 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.30 |
| IUPAC Name | 4-(7,7,10,10-tetramethyl-1-pentyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoic acid |
| SMILES | CCCCCn1cc(-c2ccc(C(=O)O)cc2)c2c1-c1cc3c(cc1CC2)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C32H39NO2/c1-6-7-8-17-33-20-26(21-9-11-22(12-10-21)30(34)35)24-14-13-23-18-27-28(19-25(23)29(24)33)32(4,5)16-15-31(27,2)3/h9-12,18-20H,6-8,13-17H2,1-5H3,(H,34,35) |
| InChIKey | ZEEMTNGTIPQMGA-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|