C13H9Br2N3O2 — CID 104798121
2,4-dibromo-6-[3-(3-methylfuran-2-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 104798121) has the molecular formula C13H9Br2N3O2 and a molecular weight of 399.04 g/mol. Its IUPAC name is 2,4-dibromo-6-[3-(3-methylfuran-2-yl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2,4-dibromo-6-[3-(3-methylfuran-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 104798121 |
| Molecular Formula | C13H9Br2N3O2 |
| Molecular Weight | 399.04 g/mol |
| Exact Mass | 396.91 |
| IUPAC Name | 2,4-dibromo-6-[3-(3-methylfuran-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Cc1ccoc1-c1noc(-c2cc(Br)cc(Br)c2N)n1 |
| InChI | InChI=1S/C13H9Br2N3O2/c1-6-2-3-19-11(6)12-17-13(20-18-12)8-4-7(14)5-9(15)10(8)16/h2-5H,16H2,1H3 |
| InChIKey | GSMXQOXDTYZOBB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.04 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|