C24H24F3N3O4 — CID 10480056
5-phenyl-1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-1,3-diazinane-2,4-dione (PubChem CID 10480056) has the molecular formula C24H24F3N3O4 and a molecular weight of 475.47 g/mol. Its IUPAC name is 5-phenyl-1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-1,3-diazinane-2,4-dione.
| Compound Name | 5-phenyl-1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 10480056 |
| Molecular Formula | C24H24F3N3O4 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 5-phenyl-1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-1,3-diazinane-2,4-dione |
| SMILES | CCCc1c(OCCCN2CC(c3ccccc3)C(=O)NC2=O)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C24H24F3N3O4/c1-2-7-16-19(11-10-17-20(16)34-29-21(17)24(25,26)27)33-13-6-12-30-14-18(22(31)28-23(30)32)15-8-4-3-5-9-15/h3-5,8-11,18H,2,6-7,12-14H2,1H3,(H,28,31,32) |
| InChIKey | JUYAYPBFCXSXMA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|