C16H19BrN2S — CID 104802758
1-(5-bromo-3-pyridinyl)-N-methyl-3-(2-methylphenyl)sulfanylpropan-2-amine (PubChem CID 104802758) has the molecular formula C16H19BrN2S and a molecular weight of 351.31 g/mol. Its IUPAC name is 1-(5-bromo-3-pyridinyl)-N-methyl-3-(2-methylphenyl)sulfanylpropan-2-amine.
| Compound Name | 1-(5-bromo-3-pyridinyl)-N-methyl-3-(2-methylphenyl)sulfanylpropan-2-amine |
|---|---|
| PubChem CID | 104802758 |
| Molecular Formula | C16H19BrN2S |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 1-(5-bromo-3-pyridinyl)-N-methyl-3-(2-methylphenyl)sulfanylpropan-2-amine |
| SMILES | CNC(CSc1ccccc1C)Cc1cncc(Br)c1 |
| InChI | InChI=1S/C16H19BrN2S/c1-12-5-3-4-6-16(12)20-11-15(18-2)8-13-7-14(17)10-19-9-13/h3-7,9-10,15,18H,8,11H2,1-2H3 |
| InChIKey | UQHQNYUDULRMMV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |