C13H17NO2 — CID 104805287
N-ethyl-2-(furan-3-yl)-1-(3-methylfuran-2-yl)ethanamine (PubChem CID 104805287) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is N-ethyl-2-(furan-3-yl)-1-(3-methylfuran-2-yl)ethanamine.
| Compound Name | N-ethyl-2-(furan-3-yl)-1-(3-methylfuran-2-yl)ethanamine |
|---|---|
| PubChem CID | 104805287 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-ethyl-2-(furan-3-yl)-1-(3-methylfuran-2-yl)ethanamine |
| SMILES | CCNC(Cc1ccoc1)c1occc1C |
| InChI | InChI=1S/C13H17NO2/c1-3-14-12(8-11-5-6-15-9-11)13-10(2)4-7-16-13/h4-7,9,12,14H,3,8H2,1-2H3 |
| InChIKey | HSTYRLVHVBYLOX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |