About 8-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]-N-butyl-N-methyloctanamide
8-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]-N-butyl-N-methyloctanamide (PubChem CID 10480544) has the molecular formula C29H43NO3S
and a molecular weight of 485.73 g/mol. Its IUPAC name is 8-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]-N-butyl-N-methyloctanamide.
Molecular Properties
| Compound Name | 8-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]-N-butyl-N-methyloctanamide |
| PubChem CID | 10480544 |
| Molecular Formula | C29H43NO3S |
| Molecular Weight | 485.73 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 8-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]-N-butyl-N-methyloctanamide |
| SMILES | CCCCN(C)C(=O)CCCCCCCSC(Cc1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H43NO3S/c1-5-6-21-30(2)29(31)12-10-8-7-9-11-22-34-28(25-15-19-27(33-4)20-16-25)23-24-13-17-26(32-3)18-14-24/h13-20,28H,5-12,21-23H2,1-4H3 |
| InChIKey | UUFVXGWFKPXCOY-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.73 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]-N-butyl-N-methyloctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]-N-butyl-N-methyloctanamide?
The IUPAC name of 8-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]-N-butyl-N-methyloctanamide (CID 10480544) is 8-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]-N-butyl-N-methyloctanamide.
What is the SMILES notation for 8-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]-N-butyl-N-methyloctanamide?
The canonical SMILES for 8-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]-N-butyl-N-methyloctanamide is CCCCN(C)C(=O)CCCCCCCSC(Cc1ccc(OC)cc1)c1ccc(OC)cc1.
What is the InChIKey of 8-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]-N-butyl-N-methyloctanamide?
The InChIKey is UUFVXGWFKPXCOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H43NO3S/c1-5-6-21-30(2)29(31)12-10-8-7-9-11-22-34-28(25-15-19-27(33-4)20-16-25)23-24-13-17-26(32-3)18-14-24/h13-20,28H,5-12,21-23H2,1-4H3.
What are the key properties of 8-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]-N-butyl-N-methyloctanamide?
8-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]-N-butyl-N-methyloctanamide has a molecular weight of 485.73 g/mol, XLogP of 7.32, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[1,2-bis(4-methoxyphenyl)ethylsulfanyl]-N-butyl-N-methyloctanamide is sourced from PubChem (CID 10480544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).