C11H12BrN3O2 — CID 104806840
5-bromo-6-(methoxymethyl)-2-(3-methylfuran-2-yl)pyrimidin-4-amine (PubChem CID 104806840) has the molecular formula C11H12BrN3O2 and a molecular weight of 298.14 g/mol. Its IUPAC name is 5-bromo-6-(methoxymethyl)-2-(3-methylfuran-2-yl)pyrimidin-4-amine.
| Compound Name | 5-bromo-6-(methoxymethyl)-2-(3-methylfuran-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 104806840 |
| Molecular Formula | C11H12BrN3O2 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 5-bromo-6-(methoxymethyl)-2-(3-methylfuran-2-yl)pyrimidin-4-amine |
| SMILES | COCc1nc(-c2occc2C)nc(N)c1Br |
| InChI | InChI=1S/C11H12BrN3O2/c1-6-3-4-17-9(6)11-14-7(5-16-2)8(12)10(13)15-11/h3-4H,5H2,1-2H3,(H2,13,14,15) |
| InChIKey | PAHONZQHOASRHX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |