C12H12IN3O — CID 104806878
6-cyclopropyl-5-iodo-2-(3-methylfuran-2-yl)pyrimidin-4-amine (PubChem CID 104806878) has the molecular formula C12H12IN3O and a molecular weight of 341.15 g/mol. Its IUPAC name is 6-cyclopropyl-5-iodo-2-(3-methylfuran-2-yl)pyrimidin-4-amine.
| Compound Name | 6-cyclopropyl-5-iodo-2-(3-methylfuran-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 104806878 |
| Molecular Formula | C12H12IN3O |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 6-cyclopropyl-5-iodo-2-(3-methylfuran-2-yl)pyrimidin-4-amine |
| SMILES | Cc1ccoc1-c1nc(N)c(I)c(C2CC2)n1 |
| InChI | InChI=1S/C12H12IN3O/c1-6-4-5-17-10(6)12-15-9(7-2-3-7)8(13)11(14)16-12/h4-5,7H,2-3H2,1H3,(H2,14,15,16) |
| InChIKey | BHYWVXZGKFZQLO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|