C25H22N4O5S — CID 10480722
N-hydroxy-3-oxo-2-phenyl-5-(4-phenylphenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide (PubChem CID 10480722) has the molecular formula C25H22N4O5S and a molecular weight of 490.54 g/mol. Its IUPAC name is N-hydroxy-3-oxo-2-phenyl-5-(4-phenylphenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide.
| Compound Name | N-hydroxy-3-oxo-2-phenyl-5-(4-phenylphenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 10480722 |
| Molecular Formula | C25H22N4O5S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | N-hydroxy-3-oxo-2-phenyl-5-(4-phenylphenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide |
| SMILES | O=C(NO)C1c2c([nH]n(-c3ccccc3)c2=O)CCN1S(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N4O5S/c30-24(27-32)23-22-21(26-29(25(22)31)19-9-5-2-6-10-19)15-16-28(23)35(33,34)20-13-11-18(12-14-20)17-7-3-1-4-8-17/h1-14,23,26,32H,15-16H2,(H,27,30) |
| InChIKey | LRIDMDRUBATENR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|