C26H23F3N4O3 — CID 10480946
5-butyl-4-[[4-(2-nitrophenyl)phenyl]methyl]-2-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-one (PubChem CID 10480946) has the molecular formula C26H23F3N4O3 and a molecular weight of 496.49 g/mol. Its IUPAC name is 5-butyl-4-[[4-(2-nitrophenyl)phenyl]methyl]-2-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-one.
| Compound Name | 5-butyl-4-[[4-(2-nitrophenyl)phenyl]methyl]-2-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 10480946 |
| Molecular Formula | C26H23F3N4O3 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 5-butyl-4-[[4-(2-nitrophenyl)phenyl]methyl]-2-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-one |
| SMILES | CCCCc1nn(-c2ccccc2C(F)(F)F)c(=O)n1Cc1ccc(-c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H23F3N4O3/c1-2-3-12-24-30-32(23-11-7-5-9-21(23)26(27,28)29)25(34)31(24)17-18-13-15-19(16-14-18)20-8-4-6-10-22(20)33(35)36/h4-11,13-16H,2-3,12,17H2,1H3 |
| InChIKey | ZOHKAKBURDXZIR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 82.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|