C16H20O3 — CID 104809675
1-(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)hex-4-yn-1-ol (PubChem CID 104809675) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 1-(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)hex-4-yn-1-ol.
| Compound Name | 1-(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)hex-4-yn-1-ol |
|---|---|
| PubChem CID | 104809675 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 1-(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)hex-4-yn-1-ol |
| SMILES | CC#CCCC(O)c1cc2c(cc1OC)CC(C)O2 |
| InChI | InChI=1S/C16H20O3/c1-4-5-6-7-14(17)13-10-15-12(8-11(2)19-15)9-16(13)18-3/h9-11,14,17H,6-8H2,1-3H3 |
| InChIKey | ACQACEAWZCUJEF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|