C17H20BrFN2 — CID 104810862
3-(5-bromo-2-pyridinyl)-2-(2-fluorophenyl)-N-propylpropan-1-amine (PubChem CID 104810862) has the molecular formula C17H20BrFN2 and a molecular weight of 351.26 g/mol. Its IUPAC name is 3-(5-bromo-2-pyridinyl)-2-(2-fluorophenyl)-N-propylpropan-1-amine.
| Compound Name | 3-(5-bromo-2-pyridinyl)-2-(2-fluorophenyl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 104810862 |
| Molecular Formula | C17H20BrFN2 |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 3-(5-bromo-2-pyridinyl)-2-(2-fluorophenyl)-N-propylpropan-1-amine |
| SMILES | CCCNCC(Cc1ccc(Br)cn1)c1ccccc1F |
| InChI | InChI=1S/C17H20BrFN2/c1-2-9-20-11-13(16-5-3-4-6-17(16)19)10-15-8-7-14(18)12-21-15/h3-8,12-13,20H,2,9-11H2,1H3 |
| InChIKey | JXZMZTPLNHYFTA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|