C14H19BrN2O — CID 104810974
[3-[(5-bromo-2-pyridinyl)methyl]-2-cyclopropyloxolan-3-yl]methanamine (PubChem CID 104810974) has the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. Its IUPAC name is [3-[(5-bromo-2-pyridinyl)methyl]-2-cyclopropyloxolan-3-yl]methanamine.
| Compound Name | [3-[(5-bromo-2-pyridinyl)methyl]-2-cyclopropyloxolan-3-yl]methanamine |
|---|---|
| PubChem CID | 104810974 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | [3-[(5-bromo-2-pyridinyl)methyl]-2-cyclopropyloxolan-3-yl]methanamine |
| SMILES | NCC1(Cc2ccc(Br)cn2)CCOC1C1CC1 |
| InChI | InChI=1S/C14H19BrN2O/c15-11-3-4-12(17-8-11)7-14(9-16)5-6-18-13(14)10-1-2-10/h3-4,8,10,13H,1-2,5-7,9,16H2 |
| InChIKey | ICNKFXBCOFPRMB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |