C28H34F2N2O4 — CID 10481106
methyl 7-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]heptanoate (PubChem CID 10481106) has the molecular formula C28H34F2N2O4 and a molecular weight of 500.59 g/mol. Its IUPAC name is methyl 7-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 10481106 |
| Molecular Formula | C28H34F2N2O4 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | methyl 7-[(5S)-3-benzyl-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]heptanoate |
| SMILES | COC(=O)CCCCCCN1C(=O)N(Cc2ccccc2)C[C@@H]1/C=C/C(O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C28H34F2N2O4/c1-36-26(34)16-10-2-3-11-19-32-24(21-31(27(32)35)20-22-12-6-4-7-13-22)17-18-25(33)28(29,30)23-14-8-5-9-15-23/h4-9,12-15,17-18,24-25,33H,2-3,10-11,16,19-21H2,1H3/b18-17+/t24-,25?/m0/s1 |
| InChIKey | XADNTLMXJOCELK-MVIWYDPTSA-N |
| XLogP | 5.13 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|