C17H21BrN2S — CID 104811507
N-[[3-[(5-bromo-3-pyridinyl)methylsulfanyl]phenyl]methyl]-2-methylpropan-2-amine (PubChem CID 104811507) has the molecular formula C17H21BrN2S and a molecular weight of 365.34 g/mol. Its IUPAC name is N-[[3-[(5-bromo-3-pyridinyl)methylsulfanyl]phenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[3-[(5-bromo-3-pyridinyl)methylsulfanyl]phenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 104811507 |
| Molecular Formula | C17H21BrN2S |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | N-[[3-[(5-bromo-3-pyridinyl)methylsulfanyl]phenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cccc(SCc2cncc(Br)c2)c1 |
| InChI | InChI=1S/C17H21BrN2S/c1-17(2,3)20-10-13-5-4-6-16(8-13)21-12-14-7-15(18)11-19-9-14/h4-9,11,20H,10,12H2,1-3H3 |
| InChIKey | VNTZQCKUTBOFKC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |