C17H21BrN2S — CID 104811511
N-[[3-[(5-bromo-2-pyridinyl)methylsulfanyl]phenyl]methyl]-2-methylpropan-1-amine (PubChem CID 104811511) has the molecular formula C17H21BrN2S and a molecular weight of 365.34 g/mol. Its IUPAC name is N-[[3-[(5-bromo-2-pyridinyl)methylsulfanyl]phenyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[3-[(5-bromo-2-pyridinyl)methylsulfanyl]phenyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 104811511 |
| Molecular Formula | C17H21BrN2S |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | N-[[3-[(5-bromo-2-pyridinyl)methylsulfanyl]phenyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1cccc(SCc2ccc(Br)cn2)c1 |
| InChI | InChI=1S/C17H21BrN2S/c1-13(2)9-19-10-14-4-3-5-17(8-14)21-12-16-7-6-15(18)11-20-16/h3-8,11,13,19H,9-10,12H2,1-2H3 |
| InChIKey | OXRLTGOLIKKFTK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |