C25H19ClN6O4 — CID 10481185
1-[6-[2-(4-chlorophenyl)indazol-5-yl]oxy-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione (PubChem CID 10481185) has the molecular formula C25H19ClN6O4 and a molecular weight of 502.92 g/mol. Its IUPAC name is 1-[6-[2-(4-chlorophenyl)indazol-5-yl]oxy-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 1-[6-[2-(4-chlorophenyl)indazol-5-yl]oxy-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 10481185 |
| Molecular Formula | C25H19ClN6O4 |
| Molecular Weight | 502.92 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 1-[6-[2-(4-chlorophenyl)indazol-5-yl]oxy-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
| SMILES | O=C1NC(=O)C2(CCCN2c2ccc(Oc3ccc4nn(-c5ccc(Cl)cc5)cc4c3)nc2)C(=O)N1 |
| InChI | InChI=1S/C25H19ClN6O4/c26-16-2-4-17(5-3-16)32-14-15-12-19(7-8-20(15)30-32)36-21-9-6-18(13-27-21)31-11-1-10-25(31)22(33)28-24(35)29-23(25)34/h2-9,12-14H,1,10-11H2,(H2,28,29,33,34,35) |
| InChIKey | CFQNPULTAKGBBA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.92 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|