C13H21BrN2 — CID 104811931
6-(5-bromo-3-pyridinyl)-2,2-dimethylhexan-3-amine (PubChem CID 104811931) has the molecular formula C13H21BrN2 and a molecular weight of 285.23 g/mol. Its IUPAC name is 6-(5-bromo-3-pyridinyl)-2,2-dimethylhexan-3-amine.
| Compound Name | 6-(5-bromo-3-pyridinyl)-2,2-dimethylhexan-3-amine |
|---|---|
| PubChem CID | 104811931 |
| Molecular Formula | C13H21BrN2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 6-(5-bromo-3-pyridinyl)-2,2-dimethylhexan-3-amine |
| SMILES | CC(C)(C)C(N)CCCc1cncc(Br)c1 |
| InChI | InChI=1S/C13H21BrN2/c1-13(2,3)12(15)6-4-5-10-7-11(14)9-16-8-10/h7-9,12H,4-6,15H2,1-3H3 |
| InChIKey | NRVANPLJJVZYNG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |