C25H20BrN3O2S — CID 10481302
2-(3,4-dihydro-2H-chromen-6-yl)-5-[1-[(3-isothiocyanatophenyl)methyl]pyridin-1-ium-4-yl]-1,3-oxazole bromide (PubChem CID 10481302) has the molecular formula C25H20BrN3O2S and a molecular weight of 506.43 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-6-yl)-5-[1-[(3-isothiocyanatophenyl)methyl]pyridin-1-ium-4-yl]-1,3-oxazole bromide.
| Compound Name | 2-(3,4-dihydro-2H-chromen-6-yl)-5-[1-[(3-isothiocyanatophenyl)methyl]pyridin-1-ium-4-yl]-1,3-oxazole bromide |
|---|---|
| PubChem CID | 10481302 |
| Molecular Formula | C25H20BrN3O2S |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-6-yl)-5-[1-[(3-isothiocyanatophenyl)methyl]pyridin-1-ium-4-yl]-1,3-oxazole bromide |
| SMILES | S=C=Nc1cccc(C[n+]2ccc(-c3cnc(-c4ccc5c(c4)CCCO5)o3)cc2)c1.[Br-] |
| InChI | InChI=1S/C25H20N3O2S.BrH/c31-17-27-22-5-1-3-18(13-22)16-28-10-8-19(9-11-28)24-15-26-25(30-24)21-6-7-23-20(14-21)4-2-12-29-23;/h1,3,5-11,13-15H,2,4,12,16H2;1H/q+1;/p-1 |
| InChIKey | ZLHULGGTEHEJGJ-UHFFFAOYSA-M |
| XLogP | 2.41 |
| TPSA | 51.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|