C12H15BrN2 — CID 104813685
(3Z)-3-[(5-bromo-2-pyridinyl)methylidene]cyclohexan-1-amine (PubChem CID 104813685) has the molecular formula C12H15BrN2 and a molecular weight of 267.17 g/mol. Its IUPAC name is (3Z)-3-[(5-bromo-2-pyridinyl)methylidene]cyclohexan-1-amine.
| Compound Name | (3Z)-3-[(5-bromo-2-pyridinyl)methylidene]cyclohexan-1-amine |
|---|---|
| PubChem CID | 104813685 |
| Molecular Formula | C12H15BrN2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | (3Z)-3-[(5-bromo-2-pyridinyl)methylidene]cyclohexan-1-amine |
| SMILES | NC1CCC/C(=C/c2ccc(Br)cn2)C1 |
| InChI | InChI=1S/C12H15BrN2/c13-10-4-5-12(15-8-10)7-9-2-1-3-11(14)6-9/h4-5,7-8,11H,1-3,6,14H2/b9-7- |
| InChIKey | NSMJNBBQBMNAKT-CLFYSBASSA-N |
| XLogP | 3.13 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |