C17H27BrN2 — CID 104813926
N-[[2-[(5-bromo-3-pyridinyl)methyl]-4-methylcyclohexyl]methyl]propan-1-amine (PubChem CID 104813926) has the molecular formula C17H27BrN2 and a molecular weight of 339.32 g/mol. Its IUPAC name is N-[[2-[(5-bromo-3-pyridinyl)methyl]-4-methylcyclohexyl]methyl]propan-1-amine.
| Compound Name | N-[[2-[(5-bromo-3-pyridinyl)methyl]-4-methylcyclohexyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 104813926 |
| Molecular Formula | C17H27BrN2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[[2-[(5-bromo-3-pyridinyl)methyl]-4-methylcyclohexyl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCC(C)CC1Cc1cncc(Br)c1 |
| InChI | InChI=1S/C17H27BrN2/c1-3-6-19-11-15-5-4-13(2)7-16(15)8-14-9-17(18)12-20-10-14/h9-10,12-13,15-16,19H,3-8,11H2,1-2H3 |
| InChIKey | MGLFKGMDKPMVIF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|