C28H34N2O7 — CID 10481441
dimethyl 4-(3,4-dimethoxyphenyl)-2,6-dimethyl-1-[3-(pyridin-3-ylmethoxy)propyl]-4H-pyridine-3,5-dicarboxylate (PubChem CID 10481441) has the molecular formula C28H34N2O7 and a molecular weight of 510.59 g/mol. Its IUPAC name is dimethyl 4-(3,4-dimethoxyphenyl)-2,6-dimethyl-1-[3-(pyridin-3-ylmethoxy)propyl]-4H-pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-(3,4-dimethoxyphenyl)-2,6-dimethyl-1-[3-(pyridin-3-ylmethoxy)propyl]-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10481441 |
| Molecular Formula | C28H34N2O7 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | dimethyl 4-(3,4-dimethoxyphenyl)-2,6-dimethyl-1-[3-(pyridin-3-ylmethoxy)propyl]-4H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)N(CCCOCc2cccnc2)C(C)=C(C(=O)OC)C1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C28H34N2O7/c1-18-24(27(31)35-5)26(21-10-11-22(33-3)23(15-21)34-4)25(28(32)36-6)19(2)30(18)13-8-14-37-17-20-9-7-12-29-16-20/h7,9-12,15-16,26H,8,13-14,17H2,1-6H3 |
| InChIKey | ROLPDRVGLVPDHN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 96.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|