C24H28F3N3O4S — CID 10481475
1-cyclopropyl-N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 10481475) has the molecular formula C24H28F3N3O4S and a molecular weight of 511.57 g/mol. Its IUPAC name is 1-cyclopropyl-N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-cyclopropyl-N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 10481475 |
| Molecular Formula | C24H28F3N3O4S |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 1-cyclopropyl-N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)(F)F)cn3)cc2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C24H28F3N3O4S/c25-24(26,27)11-1-2-17-3-10-21(28-16-17)18-4-8-20(9-5-18)35(33,34)23(22(31)29-32)12-14-30(15-13-23)19-6-7-19/h3-5,8-10,16,19,32H,1-2,6-7,11-15H2,(H,29,31) |
| InChIKey | DIBFNKHUBJDQFR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|