C14H12ClF2NO — CID 104815678
N-[(2-chloro-6-methoxyphenyl)methyl]-2,4-difluoroaniline (PubChem CID 104815678) has the molecular formula C14H12ClF2NO and a molecular weight of 283.71 g/mol. Its IUPAC name is N-[(2-chloro-6-methoxyphenyl)methyl]-2,4-difluoroaniline.
| Compound Name | N-[(2-chloro-6-methoxyphenyl)methyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 104815678 |
| Molecular Formula | C14H12ClF2NO |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-[(2-chloro-6-methoxyphenyl)methyl]-2,4-difluoroaniline |
| SMILES | COc1cccc(Cl)c1CNc1ccc(F)cc1F |
| InChI | InChI=1S/C14H12ClF2NO/c1-19-14-4-2-3-11(15)10(14)8-18-13-6-5-9(16)7-12(13)17/h2-7,18H,8H2,1H3 |
| InChIKey | QAOOUOYWEWUEOY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |