C16H26ClNO — CID 104815707
N-[(2-chloro-6-methoxyphenyl)methyl]-6-methylheptan-2-amine (PubChem CID 104815707) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is N-[(2-chloro-6-methoxyphenyl)methyl]-6-methylheptan-2-amine.
| Compound Name | N-[(2-chloro-6-methoxyphenyl)methyl]-6-methylheptan-2-amine |
|---|---|
| PubChem CID | 104815707 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-[(2-chloro-6-methoxyphenyl)methyl]-6-methylheptan-2-amine |
| SMILES | COc1cccc(Cl)c1CNC(C)CCCC(C)C |
| InChI | InChI=1S/C16H26ClNO/c1-12(2)7-5-8-13(3)18-11-14-15(17)9-6-10-16(14)19-4/h6,9-10,12-13,18H,5,7-8,11H2,1-4H3 |
| InChIKey | CFYZHQRITJIJIQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |