About tert-butyl 4-[(2S,3S)-3-benzyl-1-(benzylcarbamoyl)-3-ethyl-4-oxoazetidin-2-yl]oxybenzoate
tert-butyl 4-[(2S,3S)-3-benzyl-1-(benzylcarbamoyl)-3-ethyl-4-oxoazetidin-2-yl]oxybenzoate (PubChem CID 10481593) has the molecular formula C31H34N2O5
and a molecular weight of 514.62 g/mol. Its IUPAC name is tert-butyl 4-[(2S,3S)-3-benzyl-1-(benzylcarbamoyl)-3-ethyl-4-oxoazetidin-2-yl]oxybenzoate.
Molecular Properties
| Compound Name | tert-butyl 4-[(2S,3S)-3-benzyl-1-(benzylcarbamoyl)-3-ethyl-4-oxoazetidin-2-yl]oxybenzoate |
| PubChem CID | 10481593 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | tert-butyl 4-[(2S,3S)-3-benzyl-1-(benzylcarbamoyl)-3-ethyl-4-oxoazetidin-2-yl]oxybenzoate |
| SMILES | CC[C@@]1(Cc2ccccc2)C(=O)N(C(=O)NCc2ccccc2)[C@H]1Oc1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C31H34N2O5/c1-5-31(20-22-12-8-6-9-13-22)27(35)33(29(36)32-21-23-14-10-7-11-15-23)28(31)37-25-18-16-24(17-19-25)26(34)38-30(2,3)4/h6-19,28H,5,20-21H2,1-4H3,(H,32,36)/t28-,31+/m0/s1 |
| InChIKey | LNZMKXVXJHNYTK-QCENPCRXSA-N |
| XLogP | 5.74 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-[(2S,3S)-3-benzyl-1-(benzylcarbamoyl)-3-ethyl-4-oxoazetidin-2-yl]oxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[(2S,3S)-3-benzyl-1-(benzylcarbamoyl)-3-ethyl-4-oxoazetidin-2-yl]oxybenzoate?
The IUPAC name of tert-butyl 4-[(2S,3S)-3-benzyl-1-(benzylcarbamoyl)-3-ethyl-4-oxoazetidin-2-yl]oxybenzoate (CID 10481593) is tert-butyl 4-[(2S,3S)-3-benzyl-1-(benzylcarbamoyl)-3-ethyl-4-oxoazetidin-2-yl]oxybenzoate.
What is the SMILES notation for tert-butyl 4-[(2S,3S)-3-benzyl-1-(benzylcarbamoyl)-3-ethyl-4-oxoazetidin-2-yl]oxybenzoate?
The canonical SMILES for tert-butyl 4-[(2S,3S)-3-benzyl-1-(benzylcarbamoyl)-3-ethyl-4-oxoazetidin-2-yl]oxybenzoate is CC[C@@]1(Cc2ccccc2)C(=O)N(C(=O)NCc2ccccc2)[C@H]1Oc1ccc(C(=O)OC(C)(C)C)cc1.
What is the InChIKey of tert-butyl 4-[(2S,3S)-3-benzyl-1-(benzylcarbamoyl)-3-ethyl-4-oxoazetidin-2-yl]oxybenzoate?
The InChIKey is LNZMKXVXJHNYTK-QCENPCRXSA-N. The full InChI is InChI=1S/C31H34N2O5/c1-5-31(20-22-12-8-6-9-13-22)27(35)33(29(36)32-21-23-14-10-7-11-15-23)28(31)37-25-18-16-24(17-19-25)26(34)38-30(2,3)4/h6-19,28H,5,20-21H2,1-4H3,(H,32,36)/t28-,31+/m0/s1.
What are the key properties of tert-butyl 4-[(2S,3S)-3-benzyl-1-(benzylcarbamoyl)-3-ethyl-4-oxoazetidin-2-yl]oxybenzoate?
tert-butyl 4-[(2S,3S)-3-benzyl-1-(benzylcarbamoyl)-3-ethyl-4-oxoazetidin-2-yl]oxybenzoate has a molecular weight of 514.62 g/mol, XLogP of 5.74, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[(2S,3S)-3-benzyl-1-(benzylcarbamoyl)-3-ethyl-4-oxoazetidin-2-yl]oxybenzoate is sourced from PubChem (CID 10481593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).