About methyl 3-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl-methylamino]propanoate
methyl 3-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl-methylamino]propanoate (PubChem CID 104816662) has the molecular formula C9H17N5O5S
and a molecular weight of 307.33 g/mol. Its IUPAC name is methyl 3-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl-methylamino]propanoate.
Molecular Properties
| Compound Name | methyl 3-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl-methylamino]propanoate |
| PubChem CID | 104816662 |
| Molecular Formula | C9H17N5O5S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | methyl 3-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl-methylamino]propanoate |
| SMILES | CCOc1n[nH]c(NS(=O)(=O)N(C)CCC(=O)OC)n1 |
| InChI | InChI=1S/C9H17N5O5S/c1-4-19-9-10-8(11-12-9)13-20(16,17)14(2)6-5-7(15)18-3/h4-6H2,1-3H3,(H2,10,11,12,13) |
| InChIKey | JEEUSHQIMNNVBV-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl-methylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl-methylamino]propanoate?
The IUPAC name of methyl 3-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl-methylamino]propanoate (CID 104816662) is methyl 3-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl-methylamino]propanoate.
What is the SMILES notation for methyl 3-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl-methylamino]propanoate?
The canonical SMILES for methyl 3-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl-methylamino]propanoate is CCOc1n[nH]c(NS(=O)(=O)N(C)CCC(=O)OC)n1.
What is the InChIKey of methyl 3-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl-methylamino]propanoate?
The InChIKey is JEEUSHQIMNNVBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N5O5S/c1-4-19-9-10-8(11-12-9)13-20(16,17)14(2)6-5-7(15)18-3/h4-6H2,1-3H3,(H2,10,11,12,13).
What are the key properties of methyl 3-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl-methylamino]propanoate?
methyl 3-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl-methylamino]propanoate has a molecular weight of 307.33 g/mol, XLogP of -0.64, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(3-ethoxy-1H-1,2,4-triazol-5-yl)sulfamoyl-methylamino]propanoate is sourced from PubChem (CID 104816662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).