About [5-(2-chlorobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 2-chlorobenzoate
[5-(2-chlorobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 2-chlorobenzoate (PubChem CID 10481685) has the molecular formula C28H14Cl2O6
and a molecular weight of 517.32 g/mol. Its IUPAC name is [5-(2-chlorobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 2-chlorobenzoate.
Molecular Properties
| Compound Name | [5-(2-chlorobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 2-chlorobenzoate |
| PubChem CID | 10481685 |
| Molecular Formula | C28H14Cl2O6 |
| Molecular Weight | 517.32 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | [5-(2-chlorobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 2-chlorobenzoate |
| SMILES | O=C(Oc1cccc2c1C(=O)c1cccc(OC(=O)c3ccccc3Cl)c1C2=O)c1ccccc1Cl |
| InChI | InChI=1S/C28H14Cl2O6/c29-19-11-3-1-7-15(19)27(33)35-21-13-5-9-17-23(21)25(31)18-10-6-14-22(24(18)26(17)32)36-28(34)16-8-2-4-12-20(16)30/h1-14H |
| InChIKey | NLMPQECEJXFGLV-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.32 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-chlorobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-chlorobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 2-chlorobenzoate?
The IUPAC name of [5-(2-chlorobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 2-chlorobenzoate (CID 10481685) is [5-(2-chlorobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 2-chlorobenzoate.
What is the SMILES notation for [5-(2-chlorobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 2-chlorobenzoate?
The canonical SMILES for [5-(2-chlorobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 2-chlorobenzoate is O=C(Oc1cccc2c1C(=O)c1cccc(OC(=O)c3ccccc3Cl)c1C2=O)c1ccccc1Cl.
What is the InChIKey of [5-(2-chlorobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 2-chlorobenzoate?
The InChIKey is NLMPQECEJXFGLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H14Cl2O6/c29-19-11-3-1-7-15(19)27(33)35-21-13-5-9-17-23(21)25(31)18-10-6-14-22(24(18)26(17)32)36-28(34)16-8-2-4-12-20(16)30/h1-14H.
What are the key properties of [5-(2-chlorobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 2-chlorobenzoate?
[5-(2-chlorobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 2-chlorobenzoate has a molecular weight of 517.32 g/mol, XLogP of 6.21, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-chlorobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 2-chlorobenzoate is sourced from PubChem (CID 10481685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).