C30H40N4O4 — CID 10481794
2,5-bis[2-[ethyl-[(2-methoxyphenyl)methyl]amino]ethylamino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 10481794) has the molecular formula C30H40N4O4 and a molecular weight of 520.67 g/mol. Its IUPAC name is 2,5-bis[2-[ethyl-[(2-methoxyphenyl)methyl]amino]ethylamino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[2-[ethyl-[(2-methoxyphenyl)methyl]amino]ethylamino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10481794 |
| Molecular Formula | C30H40N4O4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 2,5-bis[2-[ethyl-[(2-methoxyphenyl)methyl]amino]ethylamino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCN(CCNC1=CC(=O)C(NCCN(CC)Cc2ccccc2OC)=CC1=O)Cc1ccccc1OC |
| InChI | InChI=1S/C30H40N4O4/c1-5-33(21-23-11-7-9-13-29(23)37-3)17-15-31-25-19-28(36)26(20-27(25)35)32-16-18-34(6-2)22-24-12-8-10-14-30(24)38-4/h7-14,19-20,31-32H,5-6,15-18,21-22H2,1-4H3 |
| InChIKey | YBQQXJJEGWLVHY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|